C21H32Si — CID 11483790
tert-butyl-[9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl]-dimethylsilane (PubChem CID 11483790) has the molecular formula C21H32Si and a molecular weight of 312.57 g/mol. Its IUPAC name is tert-butyl-[9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl]-dimethylsilane.
| Compound Name | tert-butyl-[9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl]-dimethylsilane |
|---|---|
| PubChem CID | 11483790 |
| Molecular Formula | C21H32Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl-[9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C#CCCCC#CCCC1CC1=C1CC1 |
| InChI | InChI=1S/C21H32Si/c1-21(2,3)22(4,5)16-12-10-8-6-7-9-11-13-19-17-20(19)18-14-15-18/h19H,6,8,10-11,13-15,17H2,1-5H3 |
| InChIKey | QVSYREUUYSPHSU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|