C18H26Si — CID 11196522
9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl-trimethylsilane (PubChem CID 11196522) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is 9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl-trimethylsilane.
| Compound Name | 9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl-trimethylsilane |
|---|---|
| PubChem CID | 11196522 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 9-(2-cyclopropylidenecyclopropyl)nona-1,6-diynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#CCCCC#CCCC1CC1=C1CC1 |
| InChI | InChI=1S/C18H26Si/c1-19(2,3)14-10-8-6-4-5-7-9-11-17-15-18(17)16-12-13-16/h17H,4,6,8-9,11-13,15H2,1-3H3 |
| InChIKey | WBYKTHVIHXQXAP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|