C14H17ClN2O4S — CID 110710728
3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 110710728) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 110710728 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H17ClN2O4S/c15-11-1-3-13(4-2-11)22(19,20)16-7-5-12(6-8-16)17-9-10-21-14(17)18/h1-4,12H,5-10H2 |
| InChIKey | ZIBPXMJBARPJIF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |