C16H16N2O3S — CID 110711424
(1,1-dioxo-2-phenyl-1,4-thiazinan-4-yl)-pyridin-3-ylmethanone (PubChem CID 110711424) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is (1,1-dioxo-2-phenyl-1,4-thiazinan-4-yl)-pyridin-3-ylmethanone.
| Compound Name | (1,1-dioxo-2-phenyl-1,4-thiazinan-4-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110711424 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (1,1-dioxo-2-phenyl-1,4-thiazinan-4-yl)-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCS(=O)(=O)C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H16N2O3S/c19-16(14-7-4-8-17-11-14)18-9-10-22(20,21)15(12-18)13-5-2-1-3-6-13/h1-8,11,15H,9-10,12H2 |
| InChIKey | FFNLXHUWOZSHPS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |