C12H15NO4S — CID 110711426
methyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate (PubChem CID 110711426) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate.
| Compound Name | methyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate |
|---|---|
| PubChem CID | 110711426 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate |
| SMILES | COC(=O)N1CCS(=O)(=O)C(c2ccccc2)C1 |
| InChI | InChI=1S/C12H15NO4S/c1-17-12(14)13-7-8-18(15,16)11(9-13)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3 |
| InChIKey | VFRZRRBRBMPBPO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |