C10H11NO5S — CID 134859860
methyl (5R)-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate (PubChem CID 134859860) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is methyl (5R)-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate.
| Compound Name | methyl (5R)-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134859860 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | methyl (5R)-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate |
| SMILES | COC(=O)N1C[C@@H](c2ccccc2)OS1(=O)=O |
| InChI | InChI=1S/C10H11NO5S/c1-15-10(12)11-7-9(16-17(11,13)14)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3/t9-/m0/s1 |
| InChIKey | TZBCDAJNOAPYQF-VIFPVBQESA-N |
| XLogP | 1.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |