C25H35FO4SeSi — CID 11071453
tert-butyl-[(3S,4S,5R)-2-fluoro-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-yl]oxy-dimethylsilane (PubChem CID 11071453) has the molecular formula C25H35FO4SeSi and a molecular weight of 525.60 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5R)-2-fluoro-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5R)-2-fluoro-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11071453 |
| Molecular Formula | C25H35FO4SeSi |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | tert-butyl-[(3S,4S,5R)-2-fluoro-5-[(4-methoxyphenyl)methoxy]-3-phenylselanyloxan-4-yl]oxy-dimethylsilane |
| SMILES | COc1ccc(CO[C@@H]2COC(F)[C@@H]([Se]c3ccccc3)[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H35FO4SeSi/c1-25(2,3)32(5,6)30-22-21(28-16-18-12-14-19(27-4)15-13-18)17-29-24(26)23(22)31-20-10-8-7-9-11-20/h7-15,21-24H,16-17H2,1-6H3/t21-,22+,23+,24?/m1/s1 |
| InChIKey | ZCRMLMKFJDDLQA-XDXUOVRZSA-N |
| XLogP | 5.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|