C26H41F3O7SSi — CID 11227032
[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]-3,6-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate (PubChem CID 11227032) has the molecular formula C26H41F3O7SSi and a molecular weight of 582.75 g/mol. Its IUPAC name is [(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]-3,6-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]-3,6-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11227032 |
| Molecular Formula | C26H41F3O7SSi |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]-3,6-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(COC[C@H](C)C[C@@H]2CC=C(OS(=O)(=O)C(F)(F)F)[C@@H](CCO[Si](C)(C)C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C26H41F3O7SSi/c1-19(17-33-18-20-8-10-21(32-5)11-9-20)16-22-12-13-24(36-37(30,31)26(27,28)29)23(35-22)14-15-34-38(6,7)25(2,3)4/h8-11,13,19,22-23H,12,14-18H2,1-7H3/t19-,22+,23-/m1/s1 |
| InChIKey | JOQYKBCGOPTVCA-WTIAFYNJSA-N |
| XLogP | 6.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|