C18H29F3O6SSi — CID 166445131
[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]propan-2-yl] trifluoromethanesulfonate (PubChem CID 166445131) has the molecular formula C18H29F3O6SSi and a molecular weight of 458.57 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]propan-2-yl] trifluoromethanesulfonate.
| Compound Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]propan-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166445131 |
| Molecular Formula | C18H29F3O6SSi |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]propan-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(COC[C@@H](CO[Si](C)(C)C(C)(C)C)OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H29F3O6SSi/c1-17(2,3)29(5,6)26-13-16(27-28(22,23)18(19,20)21)12-25-11-14-7-9-15(24-4)10-8-14/h7-10,16H,11-13H2,1-6H3/t16-/m0/s1 |
| InChIKey | WSDMSKSHNYVGBR-INIZCTEOSA-N |
| XLogP | 4.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|