C16H21N3O3 — CID 110715323
2-ethyl-N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]butanamide (PubChem CID 110715323) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-ethyl-N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]butanamide.
| Compound Name | 2-ethyl-N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 110715323 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-ethyl-N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(C2NC(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-4-10(5-2)14(20)17-12-8-6-11(7-9-12)13-15(21)19(3)16(22)18-13/h6-10,13H,4-5H2,1-3H3,(H,17,20)(H,18,22) |
| InChIKey | OXEJSZXKGQGTIQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|