C14H19N3O5S — CID 110719180
N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 110719180) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110719180 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCN2C(=O)CNC2=O)cc1C |
| InChI | InChI=1S/C14H19N3O5S/c1-9-7-12(10(2)6-11(9)22-3)23(20,21)16-4-5-17-13(18)8-15-14(17)19/h6-7,16H,4-5,8H2,1-3H3,(H,15,19) |
| InChIKey | QHEOPCAIVDZBQS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|