C27H32NO9PS — CID 11071944
[(1S,2S)-1-bis(phenylmethoxy)phosphoryl-2-hydroxyheptyl] 4-nitrobenzenesulfonate (PubChem CID 11071944) has the molecular formula C27H32NO9PS and a molecular weight of 577.59 g/mol. Its IUPAC name is [(1S,2S)-1-bis(phenylmethoxy)phosphoryl-2-hydroxyheptyl] 4-nitrobenzenesulfonate.
| Compound Name | [(1S,2S)-1-bis(phenylmethoxy)phosphoryl-2-hydroxyheptyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 11071944 |
| Molecular Formula | C27H32NO9PS |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | [(1S,2S)-1-bis(phenylmethoxy)phosphoryl-2-hydroxyheptyl] 4-nitrobenzenesulfonate |
| SMILES | CCCCC[C@H](O)[C@@H](OS(=O)(=O)c1ccc([N+](=O)[O-])cc1)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H32NO9PS/c1-2-3-6-15-26(29)27(37-39(33,34)25-18-16-24(17-19-25)28(30)31)38(32,35-20-22-11-7-4-8-12-22)36-21-23-13-9-5-10-14-23/h4-5,7-14,16-19,26-27,29H,2-3,6,15,20-21H2,1H3/t26-,27-/m0/s1 |
| InChIKey | KKLGZTOSWOGCOF-SVBPBHIXSA-N |
| XLogP | 6.19 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|