C12H14N2O4S2 — CID 110723421
2,5-dimethoxy-N-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 110723421) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2,5-dimethoxy-N-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110723421 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2,5-dimethoxy-N-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C)c2nccs2)c1 |
| InChI | InChI=1S/C12H14N2O4S2/c1-14(12-13-6-7-19-12)20(15,16)11-8-9(17-2)4-5-10(11)18-3/h4-8H,1-3H3 |
| InChIKey | IGDIRJAXTAMRAG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |