C12H14N2O2S2 — CID 110723615
N,2-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 110723615) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N,2-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | N,2-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110723615 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N,2-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1csc(N(C)S(=O)(=O)c2ccccc2C)n1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-9-6-4-5-7-11(9)18(15,16)14(3)12-13-10(2)8-17-12/h4-8H,1-3H3 |
| InChIKey | PGLUURBKZNXYDZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |