C15H18ClN3O2S — CID 110725892
1-[(4-chlorophenyl)methylsulfonyl]-4-(1H-imidazol-2-yl)piperidine (PubChem CID 110725892) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methylsulfonyl]-4-(1H-imidazol-2-yl)piperidine.
| Compound Name | 1-[(4-chlorophenyl)methylsulfonyl]-4-(1H-imidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 110725892 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methylsulfonyl]-4-(1H-imidazol-2-yl)piperidine |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)N1CCC(c2ncc[nH]2)CC1 |
| InChI | InChI=1S/C15H18ClN3O2S/c16-14-3-1-12(2-4-14)11-22(20,21)19-9-5-13(6-10-19)15-17-7-8-18-15/h1-4,7-8,13H,5-6,9-11H2,(H,17,18) |
| InChIKey | MZLGYRYUBXPFJJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |