C18H20ClNO4S2 — CID 121192180
4-[(4-chlorophenyl)methylsulfonyl]-7-phenyl-1,4-thiazepane 1,1-dioxide (PubChem CID 121192180) has the molecular formula C18H20ClNO4S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylsulfonyl]-7-phenyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-[(4-chlorophenyl)methylsulfonyl]-7-phenyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121192180 |
| Molecular Formula | C18H20ClNO4S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 4-[(4-chlorophenyl)methylsulfonyl]-7-phenyl-1,4-thiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)Cc2ccc(Cl)cc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C18H20ClNO4S2/c19-17-8-6-15(7-9-17)14-26(23,24)20-11-10-18(25(21,22)13-12-20)16-4-2-1-3-5-16/h1-9,18H,10-14H2 |
| InChIKey | ZAVNHSCGICUFRT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |