C19H23NO4S2 — CID 119104374
4-(3,4-dimethylphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide (PubChem CID 119104374) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-(3,4-dimethylphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 119104374 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-(3,4-dimethylphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3ccccc3)S(=O)(=O)CC2)cc1C |
| InChI | InChI=1S/C19H23NO4S2/c1-15-8-9-18(14-16(15)2)26(23,24)20-11-10-19(25(21,22)13-12-20)17-6-4-3-5-7-17/h3-9,14,19H,10-13H2,1-2H3 |
| InChIKey | WAKIACJMJVASQI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |