C13H19NO4S2 — CID 121192115
4-ethylsulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide (PubChem CID 121192115) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-ethylsulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-ethylsulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121192115 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-ethylsulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide |
| SMILES | CCS(=O)(=O)N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C13H19NO4S2/c1-2-20(17,18)14-9-8-13(19(15,16)11-10-14)12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 |
| InChIKey | NQIGYFBJGJNFHV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |