C18H21NO5S2 — CID 121192158
4-(2-methoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide (PubChem CID 121192158) has the molecular formula C18H21NO5S2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-(2-methoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121192158 |
| Molecular Formula | C18H21NO5S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-(2-methoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane 1,1-dioxide |
| SMILES | COc1ccccc1S(=O)(=O)N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C18H21NO5S2/c1-24-16-9-5-6-10-18(16)26(22,23)19-12-11-17(25(20,21)14-13-19)15-7-3-2-4-8-15/h2-10,17H,11-14H2,1H3 |
| InChIKey | PDOYQRFXDDZAJR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |