C17H22ClN3O2S — CID 72869354
1-[(4-chlorophenyl)methylsulfonyl]-4-(1-ethylimidazol-2-yl)piperidine (PubChem CID 72869354) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methylsulfonyl]-4-(1-ethylimidazol-2-yl)piperidine.
| Compound Name | 1-[(4-chlorophenyl)methylsulfonyl]-4-(1-ethylimidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 72869354 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methylsulfonyl]-4-(1-ethylimidazol-2-yl)piperidine |
| SMILES | CCn1ccnc1C1CCN(S(=O)(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H22ClN3O2S/c1-2-20-12-9-19-17(20)15-7-10-21(11-8-15)24(22,23)13-14-3-5-16(18)6-4-14/h3-6,9,12,15H,2,7-8,10-11,13H2,1H3 |
| InChIKey | GPDKYMGDXOKBEE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |