C11H17NO3S2 — CID 110727844
2,3-dimethyl-4-(5-methylthiophen-2-yl)sulfonylmorpholine (PubChem CID 110727844) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2,3-dimethyl-4-(5-methylthiophen-2-yl)sulfonylmorpholine.
| Compound Name | 2,3-dimethyl-4-(5-methylthiophen-2-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 110727844 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2,3-dimethyl-4-(5-methylthiophen-2-yl)sulfonylmorpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC(C)C2C)s1 |
| InChI | InChI=1S/C11H17NO3S2/c1-8-4-5-11(16-8)17(13,14)12-6-7-15-10(3)9(12)2/h4-5,9-10H,6-7H2,1-3H3 |
| InChIKey | DIOOWYSBTOJHOY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |