C12H10N2O3S2 — CID 110728755
N-(1,3-benzoxazol-5-yl)-5-methylthiophene-2-sulfonamide (PubChem CID 110728755) has the molecular formula C12H10N2O3S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(1,3-benzoxazol-5-yl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110728755 |
| Molecular Formula | C12H10N2O3S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3ocnc3c2)s1 |
| InChI | InChI=1S/C12H10N2O3S2/c1-8-2-5-12(18-8)19(15,16)14-9-3-4-11-10(6-9)13-7-17-11/h2-7,14H,1H3 |
| InChIKey | MLTGWMFZGJLWLK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |