C16H12N4O3S — CID 110734389
2-cyano-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzenesulfonamide (PubChem CID 110734389) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is 2-cyano-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzenesulfonamide.
| Compound Name | 2-cyano-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110734389 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-cyano-N-[(4-oxo-3H-phthalazin-1-yl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NCc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H12N4O3S/c17-9-11-5-1-4-8-15(11)24(22,23)18-10-14-12-6-2-3-7-13(12)16(21)20-19-14/h1-8,18H,10H2,(H,20,21) |
| InChIKey | LRKKIPYTUBHBFC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |