C16H13N3O4S — CID 110738480
2-cyano-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide (PubChem CID 110738480) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-cyano-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide.
| Compound Name | 2-cyano-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110738480 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-cyano-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H13N3O4S/c17-8-12-3-1-2-4-15(12)24(21,22)18-9-11-5-6-14-13(7-11)19-16(20)10-23-14/h1-7,18H,9-10H2,(H,19,20) |
| InChIKey | ZUTXNEKJHXXXKR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |