C11H13N3O — CID 110735039
N-imidazo[1,2-a]pyridin-8-ylbutanamide (PubChem CID 110735039) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is N-imidazo[1,2-a]pyridin-8-ylbutanamide.
| Compound Name | N-imidazo[1,2-a]pyridin-8-ylbutanamide |
|---|---|
| PubChem CID | 110735039 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-imidazo[1,2-a]pyridin-8-ylbutanamide |
| SMILES | CCCC(=O)Nc1cccn2ccnc12 |
| InChI | InChI=1S/C11H13N3O/c1-2-4-10(15)13-9-5-3-7-14-8-6-12-11(9)14/h3,5-8H,2,4H2,1H3,(H,13,15) |
| InChIKey | OSHBWYMNJUGFHX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |