C18H14N4O — CID 110745743
N-imidazo[1,2-a]pyridin-8-yl-4-pyrrol-1-ylbenzamide (PubChem CID 110745743) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is N-imidazo[1,2-a]pyridin-8-yl-4-pyrrol-1-ylbenzamide.
| Compound Name | N-imidazo[1,2-a]pyridin-8-yl-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 110745743 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-imidazo[1,2-a]pyridin-8-yl-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1cccn2ccnc12)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C18H14N4O/c23-18(20-16-4-3-12-22-13-9-19-17(16)22)14-5-7-15(8-6-14)21-10-1-2-11-21/h1-13H,(H,20,23) |
| InChIKey | GHAXMJFGWDEWFF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |