C16H13N3O — CID 175667850
N-imidazo[1,2-a]pyridin-8-yl-2-phenylprop-2-enamide (PubChem CID 175667850) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is N-imidazo[1,2-a]pyridin-8-yl-2-phenylprop-2-enamide.
| Compound Name | N-imidazo[1,2-a]pyridin-8-yl-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 175667850 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-imidazo[1,2-a]pyridin-8-yl-2-phenylprop-2-enamide |
| SMILES | C=C(C(=O)Nc1cccn2ccnc12)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O/c1-12(13-6-3-2-4-7-13)16(20)18-14-8-5-10-19-11-9-17-15(14)19/h2-11H,1H2,(H,18,20) |
| InChIKey | LYXXEIYXHDHREU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|