C14H11ClN4O — CID 110749184
1-(3-chlorophenyl)-3-imidazo[1,2-a]pyridin-8-ylurea (PubChem CID 110749184) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-imidazo[1,2-a]pyridin-8-ylurea.
| Compound Name | 1-(3-chlorophenyl)-3-imidazo[1,2-a]pyridin-8-ylurea |
|---|---|
| PubChem CID | 110749184 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(3-chlorophenyl)-3-imidazo[1,2-a]pyridin-8-ylurea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cccn2ccnc12 |
| InChI | InChI=1S/C14H11ClN4O/c15-10-3-1-4-11(9-10)17-14(20)18-12-5-2-7-19-8-6-16-13(12)19/h1-9H,(H2,17,18,20) |
| InChIKey | NZXRAVGGMFAPNV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |