C19H22N6O — CID 122319737
N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-4-pyrrol-1-ylbenzamide (PubChem CID 122319737) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 122319737 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-4-pyrrol-1-ylbenzamide |
| SMILES | CN(C)c1ncc(NC(=O)c2ccc(-n3cccc3)cc2)c(N(C)C)n1 |
| InChI | InChI=1S/C19H22N6O/c1-23(2)17-16(13-20-19(22-17)24(3)4)21-18(26)14-7-9-15(10-8-14)25-11-5-6-12-25/h5-13H,1-4H3,(H,21,26) |
| InChIKey | RNJZQWMHWYOUQQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |