C13H17N5O2 — CID 122319704
N-[2,4-bis(dimethylamino)pyrimidin-5-yl]furan-3-carboxamide (PubChem CID 122319704) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[2,4-bis(dimethylamino)pyrimidin-5-yl]furan-3-carboxamide.
| Compound Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 122319704 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]furan-3-carboxamide |
| SMILES | CN(C)c1ncc(NC(=O)c2ccoc2)c(N(C)C)n1 |
| InChI | InChI=1S/C13H17N5O2/c1-17(2)11-10(7-14-13(16-11)18(3)4)15-12(19)9-5-6-20-8-9/h5-8H,1-4H3,(H,15,19) |
| InChIKey | JSGFXISGBVWLDM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |