C13H23N5O — CID 91969256
N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-3-methylbutanamide (PubChem CID 91969256) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-3-methylbutanamide.
| Compound Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 91969256 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1cnc(N(C)C)nc1N(C)C |
| InChI | InChI=1S/C13H23N5O/c1-9(2)7-11(19)15-10-8-14-13(18(5)6)16-12(10)17(3)4/h8-9H,7H2,1-6H3,(H,15,19) |
| InChIKey | XLUDXTDJCWLDCX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |