C17H23N5O — CID 91969285
N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-2,5-dimethylbenzamide (PubChem CID 91969285) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-2,5-dimethylbenzamide.
| Compound Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 91969285 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-[2,4-bis(dimethylamino)pyrimidin-5-yl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2cnc(N(C)C)nc2N(C)C)c1 |
| InChI | InChI=1S/C17H23N5O/c1-11-7-8-12(2)13(9-11)16(23)19-14-10-18-17(22(5)6)20-15(14)21(3)4/h7-10H,1-6H3,(H,19,23) |
| InChIKey | JQYNQGKODVTCKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |