C15H17N3O2 — CID 110735670
N-[4-(5-methyl-1H-imidazol-4-yl)phenyl]oxolane-2-carboxamide (PubChem CID 110735670) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[4-(5-methyl-1H-imidazol-4-yl)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-(5-methyl-1H-imidazol-4-yl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 110735670 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-[4-(5-methyl-1H-imidazol-4-yl)phenyl]oxolane-2-carboxamide |
| SMILES | Cc1[nH]cnc1-c1ccc(NC(=O)C2CCCO2)cc1 |
| InChI | InChI=1S/C15H17N3O2/c1-10-14(17-9-16-10)11-4-6-12(7-5-11)18-15(19)13-3-2-8-20-13/h4-7,9,13H,2-3,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | KCGGBUIVOAEUOO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |