C16H14ClNO3S — CID 110738310
3-chloro-N-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)benzamide (PubChem CID 110738310) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)benzamide.
| Compound Name | 3-chloro-N-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)benzamide |
|---|---|
| PubChem CID | 110738310 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 3-chloro-N-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCS2(=O)=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO3S/c17-13-5-1-3-12(9-13)16(19)18-14-6-7-15-11(10-14)4-2-8-22(15,20)21/h1,3,5-7,9-10H,2,4,8H2,(H,18,19) |
| InChIKey | YFJLEPAGPCMLPK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |