C8H15N3O2S2 — CID 110739376
2-[2-(dimethylsulfamoylamino)ethyl]-5-methyl-1,3-thiazole (PubChem CID 110739376) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[2-(dimethylsulfamoylamino)ethyl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[2-(dimethylsulfamoylamino)ethyl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 110739376 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-[2-(dimethylsulfamoylamino)ethyl]-5-methyl-1,3-thiazole |
| SMILES | Cc1cnc(CCNS(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-7-6-9-8(14-7)4-5-10-15(12,13)11(2)3/h6,10H,4-5H2,1-3H3 |
| InChIKey | YACDMGSOTBFHBA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |