C13H24N2S — CID 115677197
N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]heptan-4-amine (PubChem CID 115677197) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]heptan-4-amine.
| Compound Name | N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]heptan-4-amine |
|---|---|
| PubChem CID | 115677197 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]heptan-4-amine |
| SMILES | CCCC(CCC)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C13H24N2S/c1-4-6-12(7-5-2)14-9-8-13-15-10-11(3)16-13/h10,12,14H,4-9H2,1-3H3 |
| InChIKey | JAJPRYJMIYXPMV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |