C12H14FNO2 — CID 110739662
2-(2-fluorophenyl)-1-(1,3-oxazinan-3-yl)ethanone (PubChem CID 110739662) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-(1,3-oxazinan-3-yl)ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-(1,3-oxazinan-3-yl)ethanone |
|---|---|
| PubChem CID | 110739662 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(2-fluorophenyl)-1-(1,3-oxazinan-3-yl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CCCOC1 |
| InChI | InChI=1S/C12H14FNO2/c13-11-5-2-1-4-10(11)8-12(15)14-6-3-7-16-9-14/h1-2,4-5H,3,6-9H2 |
| InChIKey | JNLXPSVXCFODIM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |