C28H29ClFNO5 — CID 1107491
propan-2-yl (4R,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1107491) has the molecular formula C28H29ClFNO5 and a molecular weight of 513.99 g/mol. Its IUPAC name is propan-2-yl (4R,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | propan-2-yl (4R,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1107491 |
| Molecular Formula | C28H29ClFNO5 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | propan-2-yl (4R,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC(C)C)[C@@H]3c2c(F)cccc2Cl)cc1OC |
| InChI | InChI=1S/C28H29ClFNO5/c1-14(2)36-28(33)24-15(3)31-20-11-17(16-9-10-22(34-4)23(13-16)35-5)12-21(32)26(20)27(24)25-18(29)7-6-8-19(25)30/h6-10,13-14,17,27,31H,11-12H2,1-5H3/t17-,27+/m0/s1 |
| InChIKey | WOOMQLRUQCCGDK-CBZJRKILSA-N |
| XLogP | 5.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |