C30H31ClFNO5 — CID 1071109
cyclopentyl (4S,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1071109) has the molecular formula C30H31ClFNO5 and a molecular weight of 540.03 g/mol. Its IUPAC name is cyclopentyl (4S,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclopentyl (4S,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1071109 |
| Molecular Formula | C30H31ClFNO5 |
| Molecular Weight | 540.03 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | cyclopentyl (4S,7S)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC2CCCC2)[C@H]3c2c(F)cccc2Cl)cc1OC |
| InChI | InChI=1S/C30H31ClFNO5/c1-16-26(30(35)38-19-7-4-5-8-19)29(27-20(31)9-6-10-21(27)32)28-22(33-16)13-18(14-23(28)34)17-11-12-24(36-2)25(15-17)37-3/h6,9-12,15,18-19,29,33H,4-5,7-8,13-14H2,1-3H3/t18-,29-/m0/s1 |
| InChIKey | DXGOFIDUCAMMGH-YRVHBCJASA-N |
| XLogP | 6.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.03 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |