C29H31ClFNO5 — CID 51667236
[(2R)-butan-2-yl] (4R,7R)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 51667236) has the molecular formula C29H31ClFNO5 and a molecular weight of 528.02 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (4R,7R)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2R)-butan-2-yl] (4R,7R)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 51667236 |
| Molecular Formula | C29H31ClFNO5 |
| Molecular Weight | 528.02 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | [(2R)-butan-2-yl] (4R,7R)-4-(2-chloro-6-fluorophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C29H31ClFNO5/c1-6-15(2)37-29(34)25-16(3)32-21-12-18(17-10-11-23(35-4)24(14-17)36-5)13-22(33)27(21)28(25)26-19(30)8-7-9-20(26)31/h7-11,14-15,18,28,32H,6,12-13H2,1-5H3/t15-,18-,28-/m1/s1 |
| InChIKey | NEHQATIQRQHWAI-NOVJBRECSA-N |
| XLogP | 6.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.02 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |