C17H24N2O — CID 110750027
N-cyclohexyl-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 110750027) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-cyclohexyl-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-cyclohexyl-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 110750027 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-cyclohexyl-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CC1Cc2ccccc2CN1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-13-11-14-7-5-6-8-15(14)12-19(13)17(20)18-16-9-3-2-4-10-16/h5-8,13,16H,2-4,9-12H2,1H3,(H,18,20) |
| InChIKey | JTMQNMBWKMCKTC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |