C17H18ClN3O — CID 110750893
1-(3-chlorophenyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)urea (PubChem CID 110750893) has the molecular formula C17H18ClN3O and a molecular weight of 315.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)urea |
|---|---|
| PubChem CID | 110750893 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)urea |
| SMILES | CN1CCC(NC(=O)Nc2cccc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C17H18ClN3O/c1-21-10-9-15(14-7-2-3-8-16(14)21)20-17(22)19-13-6-4-5-12(18)11-13/h2-8,11,15H,9-10H2,1H3,(H2,19,20,22) |
| InChIKey | KRNSEHNFXFIDAO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |