C13H18N2O5S — CID 110758981
N-(3-methoxypropyl)-4-methyl-3-oxo-1,4-benzoxazine-6-sulfonamide (PubChem CID 110758981) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-methyl-3-oxo-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-4-methyl-3-oxo-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 110758981 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(3-methoxypropyl)-4-methyl-3-oxo-1,4-benzoxazine-6-sulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C13H18N2O5S/c1-15-11-8-10(4-5-12(11)20-9-13(15)16)21(17,18)14-6-3-7-19-2/h4-5,8,14H,3,6-7,9H2,1-2H3 |
| InChIKey | QEZORPMLJFTHFK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|