C11H13ClF2N2O — CID 11076269
[2,2-difluoro-2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride (PubChem CID 11076269) has the molecular formula C11H13ClF2N2O and a molecular weight of 262.69 g/mol. Its IUPAC name is [2,2-difluoro-2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride.
| Compound Name | [2,2-difluoro-2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride |
|---|---|
| PubChem CID | 11076269 |
| Molecular Formula | C11H13ClF2N2O |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [2,2-difluoro-2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride |
| SMILES | COc1ccc2[nH]cc(C(F)(F)C[NH3+])c2c1.[Cl-] |
| InChI | InChI=1S/C11H12F2N2O.ClH/c1-16-7-2-3-10-8(4-7)9(5-15-10)11(12,13)6-14;/h2-5,15H,6,14H2,1H3;1H |
| InChIKey | OTHDQSCCDQIRPW-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |