C20H21N3O2 — CID 110771798
2-(1,3-benzoxazol-6-yl)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 110771798) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110771798 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(N2CCN(C(=O)Cc3ccc4ncoc4c3)CC2)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-15-3-2-4-17(11-15)22-7-9-23(10-8-22)20(24)13-16-5-6-18-19(12-16)25-14-21-18/h2-6,11-12,14H,7-10,13H2,1H3 |
| InChIKey | BMEUIULHMVPNNN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |