C21H21N3O3 — CID 110802161
2-(1,3-benzoxazol-6-yl)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 110802161) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110802161 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccccc1C(=O)N1CCN(C(=O)Cc2ccc3ncoc3c2)CC1 |
| InChI | InChI=1S/C21H21N3O3/c1-15-4-2-3-5-17(15)21(26)24-10-8-23(9-11-24)20(25)13-16-6-7-18-19(12-16)27-14-22-18/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | UOVXULNSPRMIQD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |