C16H20N2O2 — CID 110771791
2-(1,3-benzoxazol-6-yl)-1-(2,6-dimethylpiperidin-1-yl)ethanone (PubChem CID 110771791) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-1-(2,6-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-1-(2,6-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 110771791 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-1-(2,6-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCC(C)N1C(=O)Cc1ccc2ncoc2c1 |
| InChI | InChI=1S/C16H20N2O2/c1-11-4-3-5-12(2)18(11)16(19)9-13-6-7-14-15(8-13)20-10-17-14/h6-8,10-12H,3-5,9H2,1-2H3 |
| InChIKey | NYTUEILKTFGDJE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |