C14H16N2O2 — CID 162432742
2-(1,3-benzoxazol-5-yl)-N-cyclopentylacetamide (PubChem CID 162432742) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-5-yl)-N-cyclopentylacetamide.
| Compound Name | 2-(1,3-benzoxazol-5-yl)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 162432742 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-(1,3-benzoxazol-5-yl)-N-cyclopentylacetamide |
| SMILES | O=C(Cc1ccc2ocnc2c1)NC1CCCC1 |
| InChI | InChI=1S/C14H16N2O2/c17-14(16-11-3-1-2-4-11)8-10-5-6-13-12(7-10)15-9-18-13/h5-7,9,11H,1-4,8H2,(H,16,17) |
| InChIKey | RBDBBSPGKGTFQF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |