C20H26N4O3 — CID 110813129
4-[2-(1,3-benzoxazol-6-yl)acetyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 110813129) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[2-(1,3-benzoxazol-6-yl)acetyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(1,3-benzoxazol-6-yl)acetyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110813129 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-[2-(1,3-benzoxazol-6-yl)acetyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | O=C(Cc1ccc2ncoc2c1)N1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c25-19(13-15-6-7-17-18(12-15)27-14-21-17)23-8-10-24(11-9-23)20(26)22-16-4-2-1-3-5-16/h6-7,12,14,16H,1-5,8-11,13H2,(H,22,26) |
| InChIKey | LMZAPLYNZBWYCU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |