C13H23N3O — CID 110775522
1-tert-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methyl]urea (PubChem CID 110775522) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-tert-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methyl]urea.
| Compound Name | 1-tert-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 110775522 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-tert-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methyl]urea |
| SMILES | Cc1cc(CNC(=O)NC(C)(C)C)c(C)n1C |
| InChI | InChI=1S/C13H23N3O/c1-9-7-11(10(2)16(9)6)8-14-12(17)15-13(3,4)5/h7H,8H2,1-6H3,(H2,14,15,17) |
| InChIKey | WICNAXCJSGWZJR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |